![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| albumart.jpg | 2008-11-14 08:32 | 95K | |
| Thumbs.db | 2008-11-26 05:50 | 5.5K | |
| 11 Wonderless.mp3 | 2008-11-14 08:35 | 8.2M | |
| 10 Diamonds And Why Men Buy Them.mp3 | 2008-11-14 08:35 | 4.0M | |
| 09 Drella.mp3 | 2008-11-14 08:35 | 3.6M | |
| 08 The Balcony Scene.mp3 | 2008-11-14 08:35 | 4.8M | |
| 07 She Sings In The Morning.mp3 | 2008-11-14 08:35 | 5.1M | |
| 06 Falling Asleep On A Stranger.mp3 | 2008-11-14 08:35 | 5.5M | |
| 05 The Cheap Bouquet.mp3 | 2008-11-14 08:35 | 5.7M | |
| 04 I'd Rather Die Than Be Famous.mp3 | 2008-11-14 08:35 | 4.9M | |
| 03 Yeah Boy And Doll Face.mp3 | 2008-11-14 08:35 | 6.7M | |
| 02 Currents Convulsive.mp3 | 2008-11-14 08:35 | 6.2M | |
| 01 Chemical Kids And Mechanical BridES.mp3 | 2008-11-14 08:35 | 5.3M | |