![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 This Calling.mp3 | 2007-09-09 22:39 | 5.0M | |
| 02 Not Alone.mp3 | 2007-09-09 22:44 | 4.8M | |
| 03 It Dwells in Me.mp3 | 2007-09-09 22:33 | 4.4M | |
| 04 We Stand.mp3 | 2007-09-09 22:45 | 5.2M | |
| 05 Whispers (I Hear Your).mp3 | 2007-09-09 22:37 | 5.0M | |
| 06 The Weak Willed.mp3 | 2007-09-09 22:45 | 5.6M | |
| 07 Six.mp3 | 2007-09-09 22:17 | 4.6M | |
| 08 Become the Catalyst.mp3 | 2007-09-09 22:36 | 4.3M | |
| 09 The Air That I Breathe.mp3 | 2007-09-09 22:45 | 4.9M | |
| 10 Empty Inside.mp3 | 2007-09-09 22:43 | 4.6M | |
| 11 Indictment.mp3 | 2007-09-09 22:45 | 5.1M | |