![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Crush Mode.mp3 | 2010-12-28 23:11 | 96M | |
| 05 Pretty Boy Swag.mp3 | 2013-01-17 21:31 | 9.1M | |
| 2Pac/ | 2018-12-30 19:08 | - | |
| 12-the_human_abstract-vela_together_we_await_the_storm.mp3 | 2007-12-14 01:09 | 8.3M | |
| 28 Days Later Soundtrack/ | 2018-12-30 19:08 | - | |
| 30_Seconds_To_Mars-A_Beautiful_Lie-2005-h8me/ | 2018-12-30 19:08 | - | |
| 31 - Santana - Black Magic Woman.mp3 | 2007-11-12 04:01 | 9.1M | |
| 43 - Eric Johnson - Cliffs Of Dover.mp3 | 2007-12-14 09:01 | 6.1M | |
| 47 - An Endless Sporadic - Impulse.mp3 | 2007-12-14 09:01 | 4.0M | |
| 69 - The Sleeping - Don't Hold Back.mp3 | 2008-03-30 23:16 | 6.9M | |
| 311/ | 2018-12-30 19:08 | - | |
| AC-DC/ | 2018-12-30 19:08 | - | |
| AFI - Bleed Black.mp3 | 2007-06-22 06:56 | 5.7M | |
| AFI - The Leaving Song .mp3 | 2005-03-22 08:58 | 3.8M | |
| AFI/ | 2018-12-30 19:08 | - | |
| ASAP Ferg/ | 2018-12-30 19:09 | - | |
| ASAP Rocky/ | 2018-12-30 19:09 | - | |
| ATB/ | 2018-12-30 19:10 | - | |
| A Thorn For Every Heart/ | 2018-12-30 19:08 | - | |
| A Tribe Called Quest/ | 2018-12-30 19:08 | - | |
| Acceptance/ | 2018-12-30 19:08 | - | |
| Aerosmith/ | 2018-12-30 19:08 | - | |
| Against Me!/ | 2018-12-30 19:08 | - | |
| Aiden/ | 2018-12-30 19:08 | - | |
| Alexisonfire & City and Colour Discography (2002-2006)/ | 2018-12-30 19:08 | - | |
| Alexisonfire - 44 Caliber Love Letter.mp3 | 2007-02-06 03:00 | 4.1M | |
| Alice Cooper/ | 2018-12-30 19:08 | - | |
| Alien Ant Farm/ | 2018-12-30 19:08 | - | |
| Alkaline Trio/ | 2018-12-30 19:08 | - | |
| All-American Rejects/ | 2018-12-30 19:09 | - | |
| All That Remains/ | 2018-12-30 19:08 | - | |
| Amon Amarth/ | 2018-12-30 19:09 | - | |
| Anberlin/ | 2018-12-30 19:09 | - | |
| Andre Nickatina/ | 2018-12-30 19:09 | - | |
| Angels and Airwaves/ | 2018-12-30 19:09 | - | |
| Animal Collective/ | 2018-12-30 19:09 | - | |
| Anti-Flag/ | 2018-12-30 19:09 | - | |
| Arctic Monkeys/ | 2018-12-30 19:09 | - | |
| Armin Van Buuren/ | 2018-12-30 19:09 | - | |
| Armor For Sleep/ | 2018-12-30 19:09 | - | |
| Arsonists Get All The Girls/ | 2018-12-30 19:09 | - | |
| As Blood Runs Black - Allegiance/ | 2018-12-30 19:09 | - | |
| As Cities Burn/ | 2018-12-30 19:09 | - | |
| As I Lay Dying/ | 2018-12-30 19:09 | - | |
| Asia/ | 2018-12-30 19:09 | - | |
| At The Drive-In/ | 2018-12-30 19:10 | - | |
| Ataris/ | 2018-12-30 19:10 | - | |
| Atmosphere/ | 2018-12-30 19:10 | - | |
| Atreyu/ | 2018-12-30 19:10 | - | |
| August Burns Red/ | 2018-12-30 19:10 | - | |
| Augustana/ | 2018-12-30 19:10 | - | |
| Avenged Sevenfold/ | 2018-12-30 19:10 | - | |
| Avicii/ | 2018-12-30 19:10 | - | |
| Awolnation/ | 2018-12-30 19:10 | - | |
| Ayreon - Across The Rainbow Bridge.mp3 | 2006-01-08 19:37 | 8.7M | |
| Basshunter/ | 2018-12-30 19:10 | - | |
| Bastille/ | 2018-12-30 19:10 | - | |
| Bayside/ | 2018-12-30 19:10 | - | |
| Beck/ | 2018-12-30 19:10 | - | |
| Benny Bennasi/ | 2018-12-30 19:10 | - | |
| Biggie Smalls/ | 2018-12-30 19:10 | - | |
| Billy Idol/ | 2018-12-30 19:10 | - | |
| Black Flag/ | 2018-12-30 19:10 | - | |
| Bleed The Sky/ | 2018-12-30 19:11 | - | |
| BlessTheFall/ | 2018-12-30 19:11 | - | |
| Blink-182/ | 2018-12-30 19:11 | - | |
| Blink 182 Growing up.mp3 | 2011-08-17 00:58 | 2.2M | |
| Bloc Party/ | 2018-12-30 19:11 | - | |
| Bloodhound Gang/ | 2018-12-30 19:11 | - | |
| Blue Oyster Cult/ | 2018-12-30 19:11 | - | |
| Bob Dylan/ | 2018-12-30 19:11 | - | |
| Bob Marley/ | 2018-12-30 19:11 | - | |
| Bone Thugs-N-Harmony/ | 2018-12-30 19:11 | - | |
| Boxcar Racer/ | 2018-12-30 19:11 | - | |
| Boys_Like_Girls-Boys_Like_Girls-(Advance)-2006-MP3/ | 2018-12-30 19:11 | - | |
| Boyz II Men/ | 2018-12-30 19:11 | - | |
| Brand New/ | 2018-12-30 19:11 | - | |
| Bravery/ | 2018-12-30 19:11 | - | |
| Bright Eyes/ | 2018-12-30 19:11 | - | |
| Brotha Lynch Hung/ | 2018-12-30 19:11 | - | |
| Bullet For My Valentine/ | 2018-12-30 19:12 | - | |
| CKY/ | 2018-12-30 19:12 | - | |
| Cage The Elephant/ | 2018-12-30 19:12 | - | |
| Cake/ | 2018-12-30 19:12 | - | |
| Caliban/ | 2018-12-30 19:12 | - | |
| Cartel-Chroma-(Advance)-2005-ePH_INT/ | 2018-12-30 19:12 | - | |
| Catherine-Rumour_Has_it_Astaroth_Has_Stolen_Your_Eyes-(Advance)-2006-MP3/ | 2018-12-30 19:12 | - | |
| Chemical Vocation [2005] Chemical Vocation (EP)/ | 2018-12-30 19:12 | - | |
| Children of Bodom/ | 2018-12-30 19:12 | - | |
| Chiodos/ | 2018-12-30 19:12 | - | |
| Chrispy/ | 2018-12-30 19:12 | - | |
| Circa Survive - Sounds of Animals Fighting.mp3 | 2006-05-17 08:26 | 6.3M | |
| Circa Survive/ | 2018-12-30 19:12 | - | |
| Classical/ | 2018-12-30 19:12 | - | |
| Coheed And Cambria/ | 2018-12-30 19:12 | - | |
| Cold War Kids/ | 2018-12-30 19:12 | - | |
| Coldplay/ | 2018-12-30 19:12 | - | |
| Comeback Kid - Turn It Around/ | 2018-12-30 19:13 | - | |
| Copeland/ | 2018-12-30 19:13 | - | |
| Cursive/ | 2018-12-30 19:13 | - | |
| Cute is What We Aim For/ | 2018-12-30 19:13 | - | |
| DJ Tiesto/ | 2018-12-30 19:18 | - | |
| Daft Punk - Random Access Memories [2013] 320/ | 2018-12-30 19:13 | - | |
| Daft Punk/ | 2018-12-30 19:13 | - | |
| Damian Marley/ | 2018-12-30 19:13 | - | |
| Dance Gavin Dance/ | 2018-12-30 19:13 | - | |
| Daphne Loves Derby/ | 2018-12-30 19:13 | - | |
| Dashboard Confessional/ | 2018-12-30 19:14 | - | |
| Dave Matthews Band/ | 2018-12-30 19:14 | - | |
| David Bowie/ | 2018-12-30 19:14 | - | |
| Dead Kennedys/ | 2018-12-30 19:14 | - | |
| Dead Prez/ | 2018-12-30 19:14 | - | |
| Deadmau5/ | 2018-12-30 19:15 | - | |
| Death Cab For Cutie/ | 2018-12-30 19:15 | - | |
| Death from Above 1979/ | 2018-12-30 19:15 | - | |
| Def Leppard/ | 2018-12-30 19:15 | - | |
| Deftones/ | 2018-12-30 19:15 | - | |
| Del Tha Funkee Homosapien/ | 2018-12-30 19:16 | - | |
| Depeche Mode - The Best Of - 2006/ | 2018-12-30 19:17 | - | |
| Destroy the Champion/ | 2018-12-30 19:17 | - | |
| Dillon Francis/ | 2018-12-30 19:17 | - | |
| Dio/ | 2018-12-30 19:17 | - | |
| Dire Straights/ | 2018-12-30 19:18 | - | |
| Discovery/ | 2018-12-30 19:18 | - | |
| Disturbed/ | 2018-12-30 19:18 | - | |
| Does It Offend You, Yeah/ | 2018-12-30 19:18 | - | |
| Dom Kennedy/ | 2018-12-30 19:19 | - | |
| Donnie darko/ | 2018-12-30 19:19 | - | |
| Dope - Die Mother Fucker Die.mp3 | 2007-06-22 06:56 | 4.3M | |
| Dr. Dre/ | 2018-12-30 19:19 | - | |
| Dream To Make Believe Cover.mp3 | 2007-12-15 21:26 | 2.7M | |
| Earth Wind and Fire - Greatest Hits/ | 2018-12-30 19:19 | - | |
| Easy Star All Stars/ | 2018-12-30 19:19 | - | |
| Eazy E/ | 2018-12-30 19:19 | - | |
| Edward Maya feat Alicia - Stereo love (extend version).mp3 | 2011-02-28 21:48 | 7.8M | |
| Emery/ | 2018-12-30 19:20 | - | |
| Emotion_98.3/ | 2018-12-30 19:20 | - | |
| Empire Of The Sun/ | 2018-12-30 19:20 | - | |
| Eric Clapton/ | 2018-12-30 19:21 | - | |
| Escape The Fate/ | 2018-12-30 19:21 | - | |
| Everytime i die/ | 2018-12-30 19:21 | - | |
| Fall Out Boy/ | 2018-12-30 19:21 | - | |
| Falling Apart.mp3 | 2007-06-22 06:56 | 3.6M | |
| Far East Movement - Like A G6 (Speaker Junkies Remix).mp3 | 2010-10-16 08:38 | 8.4M | |
| Far East Movement/ | 2018-12-30 19:22 | - | |
| Fire From The Gods/ | 2018-12-30 19:22 | - | |
| Flux Pavilion/ | 2018-12-30 19:22 | - | |
| Flying Lotus/ | 2018-12-30 19:22 | - | |
| Foo Fighters/ | 2018-12-30 19:23 | - | |
| Foster The People/ | 2018-12-30 19:23 | - | |
| From Autumn to Ashes/ | 2018-12-30 19:23 | - | |
| From First To Last - Dear Diary, My Teen Angst Has A Body Count/ | 2018-12-30 19:23 | - | |
| From_First_To_Last-Heroine-2006-h8me/ | 2018-12-30 19:23 | - | |
| Fun/ | 2018-12-30 19:23 | - | |
| George Clinton & Parliament Funkadelic/ | 2018-12-30 19:23 | - | |
| Ghostface Killah/ | 2018-12-30 19:23 | - | |
| Gnarles Barkley - Crazy.mp3 | 2007-02-06 03:00 | 5.5M | |
| GodSmack/ | 2018-12-30 19:23 | - | |
| Goo Goo Dolls/ | 2018-12-30 19:23 | - | |
| Gorillaz/ | 2018-12-30 19:26 | - | |
| Gotye/ | 2018-12-30 19:26 | - | |
| Grateful Dead - The Very Best Of (2003)/ | 2018-12-30 19:27 | - | |
| Gratitude/ | 2018-12-30 19:27 | - | |
| Greeley Estates/ | 2018-12-30 19:27 | - | |
| Green Day-04-Boulevard Of Broken Dreams.mp3 | 2007-06-22 06:56 | 6.0M | |
| Green Day/ | 2018-12-30 19:28 | - | |
| GroupLove/ | 2018-12-30 19:28 | - | |
| Gucci Mane/ | 2018-12-30 19:28 | - | |
| Guns N Roses - Welcome To The Jungle.mp3 | 2007-08-17 07:10 | 4.2M | |
| Guns n' Roses/ | 2018-12-30 19:28 | - | |
| Gwar/ | 2018-12-30 19:28 | - | |
| Gym Class Heroes/ | 2018-12-30 19:28 | - | |
| HIM/ | 2018-12-30 19:29 | - | |
| Hazel and Vine/ | 2018-12-30 19:28 | - | |
| Head_Automatica-Popaganda-(Advance)-2006-tLOC/ | 2018-12-30 19:28 | - | |
| He is Legend/ | 2018-12-30 19:28 | - | |
| Hellogoodbye - ZOMBIES! ALIENS! VAMPIRES! DINOSAURS! (2006)/ | 2018-12-30 19:28 | - | |
| Hives/ | 2018-12-30 19:29 | - | |
| Hollywood Undead/ | 2018-12-30 19:29 | - | |
| Horse the Band Discography/ | 2018-12-30 19:29 | - | |
| INSTRUMENTALS/ | 2018-12-30 19:31 | - | |
| I_Am_Ghost-Lovers_Requiem XsXeX/ | 2018-12-30 19:36 | - | |
| Ice Cube/ | 2018-12-30 19:29 | - | |
| Immortal Technique/ | 2018-12-30 19:29 | - | |
| In Flames/ | 2018-12-30 19:30 | - | |
| InMe/ | 2018-12-30 19:30 | - | |
| Incubus/ | 2018-12-30 19:30 | - | |
| Interpol/ | 2018-12-30 19:31 | - | |
| Iphone Memos/ | 2018-12-30 19:31 | - | |
| Iration/ | 2018-12-30 19:31 | - | |
| Iron Maiden/ | 2018-12-30 19:31 | - | |
| Jack Johnson/ | 2018-12-30 19:36 | - | |
| Jason Mraz/ | 2018-12-30 19:36 | - | |
| Jay-Z/ | 2018-12-30 19:36 | - | |
| Jaymes Young/ | 2018-12-30 19:36 | - | |
| Jefferson Airplane/ | 2018-12-30 19:36 | - | |
| Jim Croce - The Jim Croce Collection/ | 2018-12-30 19:36 | - | |
| Jimmy Eat World/ | 2018-12-30 19:36 | - | |
| Job For A Cowboy - Doom/ | 2018-12-30 19:36 | - | |
| JobForACowboy- Genesis/ | 2018-12-30 19:37 | - | |
| John Mayer/ | 2018-12-30 19:37 | - | |
| Journey/ | 2018-12-30 19:37 | - | |
| Judas Priest/ | 2018-12-30 19:37 | - | |
| Jumpstyle/ | 2018-12-30 19:37 | - | |
| Jurassic 5/ | 2018-12-30 19:37 | - | |
| Justice/ | 2018-12-30 19:37 | - | |
| Kansas-The_Best_Of_Kansas-(Retail)-2000-HHI/ | 2018-12-30 19:37 | - | |
| Kanye West/ | 2018-12-30 19:37 | - | |
| Kendrick Lamar/ | 2018-12-30 19:38 | - | |
| Kid Cudi/ | 2018-12-30 19:39 | - | |
| Killswitch Engage/ | 2018-12-30 19:39 | - | |
| Kiss/ | 2018-12-30 19:39 | - | |
| Kitsune/ | 2018-12-30 19:40 | - | |
| Korn/ | 2018-12-30 19:40 | - | |
| Lagwagon - Razorburn.mp3 | 2007-08-17 07:10 | 2.1M | |
| Lamb Of God/ | 2018-12-30 19:40 | - | |
| Led Zeppelin - The Best Of Led Zeppelin Early Days Vol 1/ | 2018-12-30 19:41 | - | |
| Lifehouse/ | 2018-12-30 19:41 | - | |
| Lil Wayne/ | 2018-12-30 19:41 | - | |
| Limewire dl's/ | 2018-12-30 19:42 | - | |
| Linkin Park/ | 2018-12-30 19:42 | - | |
| Lithium.mp3 | 2007-09-28 04:13 | 3.9M | |
| Lmfao/ | 2018-12-30 19:42 | - | |
| Logic/ | 2018-12-30 19:43 | - | |
| Lord of the Rings - Two Towers Trailer Song (Clint Mansell - Requiem for a Dream Remix).mp3 | 2007-02-06 02:59 | 5.6M | |
| Lost Prophets/ | 2018-12-30 19:43 | - | |
| LoveHateHero/ | 2018-12-30 19:43 | - | |
| Ludacris/ | 2018-12-30 19:43 | - | |
| Lydia/ | 2018-12-30 19:43 | - | |
| Lynyrd Skynyrd/ | 2018-12-30 19:43 | - | |
| M.I.A/ | 2018-12-30 19:43 | - | |
| M83/ | 2018-12-30 19:43 | - | |
| MC Hammer/ | 2018-12-30 19:45 | - | |
| MGMT/ | 2018-12-30 19:46 | - | |
| Madona/ | 2018-12-30 19:44 | - | |
| Marshall Tucker Band/ | 2018-12-30 19:44 | - | |
| Marvin Gaye/ | 2018-12-30 19:44 | - | |
| Matt and Kim/ | 2018-12-30 19:44 | - | |
| Maylene & The Sons Of Disaster/ | 2018-12-30 19:45 | - | |
| Megadeath - Symphony of Destruction.mp3 | 2007-06-22 06:56 | 3.7M | |
| Metallica/ | 2018-12-30 19:45 | - | |
| Mexican.mp3 | 2013-07-29 00:03 | 2.4M | |
| Miami Horror/ | 2018-12-30 19:46 | - | |
| Micheal Jackson/ | 2018-12-30 19:46 | - | |
| Minus The Bear/ | 2018-12-30 19:46 | - | |
| Mobb Deep/ | 2018-12-30 19:46 | - | |
| Modest Mouse/ | 2018-12-30 19:47 | - | |
| Motion City Soundtrack/ | 2018-12-30 19:47 | - | |
| Motley Crue/ | 2018-12-30 19:47 | - | |
| Mr Suicide Sheep/ | 2018-12-30 19:47 | - | |
| Mt Eden/ | 2018-12-30 19:48 | - | |
| Mumford And Sons/ | 2018-12-30 19:48 | - | |
| Muse/ | 2018-12-30 19:48 | - | |
| Mute Math/ | 2018-12-30 19:48 | - | |
| My American Heart - The Meaning In Makeup/ | 2018-12-30 19:48 | - | |
| My Chemical Romance - I'm Not Okay(I Promise).mp3 | 2005-03-22 08:52 | 4.3M | |
| My Chemical Romance - The Black Parade/ | 2018-12-30 19:49 | - | |
| My Chemical Romance/ | 2018-12-30 19:48 | - | |
| My Morning Jacket/ | 2018-12-30 19:49 | - | |
| My Recordings/ | 2014-01-12 11:41 | - | |
| NOFX/ | 2018-12-30 19:50 | - | |
| NWA/ | 2018-12-30 19:50 | - | |
| Name Taken/ | 2018-12-30 19:49 | - | |
| Nas/ | 2018-12-30 19:49 | - | |
| Neil Young/ | 2018-12-30 19:49 | - | |
| Nena - 99 luftballons.mp3 | 2007-09-20 06:01 | 3.6M | |
| Neon Trees/ | 2018-12-30 19:49 | - | |
| Nero/ | 2018-12-30 19:49 | - | |
| Netsky/ | 2018-12-30 19:49 | - | |
| Neutral Milk Hotel/ | 2018-12-30 19:50 | - | |
| New Found Glory/ | 2018-12-30 19:50 | - | |
| Nightmares on Wax/ | 2018-12-30 19:50 | - | |
| Nightwish - Ghost Love Score.mp3 | 2007-06-22 06:56 | 727K | |
| Nine Inch Nails/ | 2018-12-30 19:50 | - | |
| Nipsey Hustle/ | 2018-12-30 19:50 | - | |
| Nirvana/ | 2018-12-30 19:50 | - | |
| Norma Jean/ | 2018-12-30 19:50 | - | |
| Oasis/ | 2018-12-30 19:51 | - | |
| Odesza/ | 2018-12-30 19:51 | - | |
| Offspring/ | 2018-12-30 19:51 | - | |
| Outkast/ | 2018-12-30 19:51 | - | |
| Ozzy Ozbourne - Crazy Train.mp3 | 2005-03-24 10:23 | 4.5M | |
| P.O.D/ | 2018-12-30 19:52 | - | |
| P.S. I Love You OST/ | 2018-12-30 19:52 | - | |
| Panic! At The Disco/ | 2018-12-30 19:52 | - | |
| Paramore/ | 2018-12-30 19:52 | - | |
| Passion Pit/ | 2018-12-30 19:52 | - | |
| Paul McCartney/ | 2018-12-30 19:52 | - | |
| Paul Van Dyke/ | 2018-12-30 19:52 | - | |
| Pearl Jam/ | 2018-12-30 19:53 | - | |
| Pheonix/ | 2018-12-30 19:53 | - | |
| Phish/ | 2018-12-30 19:53 | - | |
| Pierce the Viel/ | 2018-12-30 19:53 | - | |
| Pinback/ | 2018-12-30 19:53 | - | |
| Pink Floyd/ | 2018-12-30 19:53 | - | |
| Placebo - Without You I'm Nothing/ | 2018-12-30 19:54 | - | |
| Plain White T's/ | 2018-12-30 19:54 | - | |
| Plastic bertrand - Ça plane pour moi.mp3 | 2007-09-20 07:27 | 4.1M | |
| Plus_44-When_Your_Heart_Stops_Beating-2006-RNS/ | 2018-12-30 19:54 | - | |
| Porter Robinson/ | 2018-12-30 19:54 | - | |
| Portishead/ | 2018-12-30 19:54 | - | |
| Postal Service/ | 2018-12-30 19:54 | - | |
| Pressure 4-5/ | 2018-12-30 19:54 | - | |
| Pretty Lights/ | 2018-12-30 19:55 | - | |
| Prince/ | 2018-12-30 19:55 | - | |
| Protest The Hero/ | 2018-12-30 19:55 | - | |
| Psychostick/ | 2018-12-30 19:55 | - | |
| Queen/ | 2018-12-30 19:55 | - | |
| Queens of the Stoneage/ | 2018-12-30 19:55 | - | |
| Quiet Riot/ | 2018-12-30 19:55 | - | |
| REM/ | 2018-12-30 19:58 | - | |
| Ra Ra Riot/ | 2018-12-30 19:55 | - | |
| Radiohead/ | 2018-12-30 19:56 | - | |
| Rage Against The Machine/ | 2018-12-30 19:56 | - | |
| Rammstein/ | 2018-12-30 19:57 | - | |
| Rap/ | 2018-12-30 19:57 | - | |
| Rape Me.mp3 | 2007-06-22 06:56 | 2.6M | |
| Ratatat/ | 2018-12-30 19:57 | - | |
| Ray Charles/ | 2018-12-30 19:58 | - | |
| Rebelution/ | 2018-12-30 19:58 | - | |
| Red Hot Chili Peppers/ | 2018-12-30 19:58 | - | |
| Red Jumpsuit Apparatus/ | 2018-12-30 19:58 | - | |
| Relient K/ | 2018-12-30 19:58 | - | |
| Rick James/ | 2018-12-30 19:58 | - | |
| Rise Against/ | 2018-12-30 19:58 | - | |
| Ronald Jenkees/ | 2018-12-30 19:58 | - | |
| Rooney/ | 2018-12-30 19:58 | - | |
| Rufio/ | 2018-12-30 19:59 | - | |
| Rush/ | 2018-12-30 19:59 | - | |
| Sample Music/ | 2018-12-30 19:59 | - | |
| Saosin/ | 2018-12-30 19:59 | - | |
| Say Anything/ | 2018-12-30 19:59 | - | |
| ScaryKidsScaringKids-TheCitySleepsInFlames-(Advance)/ | 2018-12-30 19:59 | - | |
| Scientist/ | 2018-12-30 19:59 | - | |
| Scorpions/ | 2018-12-30 19:59 | - | |
| Secondhand Serenade/ | 2018-12-30 20:00 | - | |
| Secret Lives of the Freemasons/ | 2018-12-30 20:00 | - | |
| Senses Fail/ | 2018-12-30 20:00 | - | |
| Seven Lions/ | 2018-12-30 20:01 | - | |
| Sherwood/ | 2018-12-30 20:01 | - | |
| Shiny Toy Guns - We Are Pilots/ | 2018-12-30 20:01 | - | |
| Silverstein/ | 2018-12-30 20:01 | - | |
| Silversun Pickups - Carnavas [2006]/ | 2018-12-30 20:01 | - | |
| Sixpense None the Richer - Kiss me.mp3 | 2008-03-27 16:32 | 2.3M | |
| Sixpense None the Richer/ | 2018-12-30 20:01 | - | |
| Skrillex/ | 2018-12-30 20:01 | - | |
| Sky Eats Airplane/ | 2018-12-30 20:01 | - | |
| Sleeping With Sirens/ | 2018-12-30 20:02 | - | |
| Snoop Dogg/ | 2018-12-30 20:02 | - | |
| Snow Patrol/ | 2018-12-30 20:02 | - | |
| Something Corporate/ | 2018-12-30 20:02 | - | |
| Soundgarden - 1994 - Superunknown (320kbps) KindMetalRG/ | 2018-12-30 20:02 | - | |
| Spitalfield-Better_Than_Knowing_Where_You_Are-2006- XsXeX/ | 2018-12-30 20:02 | - | |
| Staind/ | 2018-12-30 20:02 | - | |
| Steve Miller Band/ | 2018-12-30 20:02 | - | |
| Stone Temple Pilots/ | 2018-12-30 20:03 | - | |
| Story Of The Year/ | 2018-12-30 20:03 | - | |
| Styx/ | 2018-12-30 20:03 | - | |
| Sublime/ | 2018-12-30 20:03 | - | |
| Suicidal Tendencies/ | 2018-12-30 20:04 | - | |
| Sum 41 - Rhythms.mp3 | 2007-06-22 06:56 | 2.7M | |
| Sum 41/ | 2018-12-30 20:04 | - | |
| System of a Down/ | 2018-12-30 20:04 | - | |
| TRUSTcompany - Downfall.mp3 | 2007-02-06 03:00 | 2.6M | |
| Taking Back Sunday/ | 2018-12-30 20:05 | - | |
| Team America/ | 2018-12-30 20:05 | - | |
| Tears For Fears/ | 2018-12-30 20:05 | - | |
| Tech N9ne/ | 2018-12-30 20:05 | - | |
| Teddy Geiger/ | 2018-12-30 20:05 | - | |
| The Academy Is... - Santi/ | 2018-12-30 20:05 | - | |
| The Almost/ | 2018-12-30 20:05 | - | |
| The Arcade Fire/ | 2018-12-30 20:05 | - | |
| The Audition/ | 2018-12-30 20:05 | - | |
| The Beach Boys/ | 2018-12-30 20:05 | - | |
| The Beastie Boys/ | 2018-12-30 20:05 | - | |
| The Beatles/ | 2018-12-30 20:06 | - | |
| The Bee Gees/ | 2018-12-30 20:06 | - | |
| The Black Dahlia Murder - Miasma/ | 2018-12-30 20:06 | - | |
| The Black Eyed Peas/ | 2018-12-30 20:06 | - | |
| The Black Keys/ | 2018-12-30 20:06 | - | |
| The Bled/ | 2018-12-30 20:07 | - | |
| The Casualties/ | 2018-12-30 20:07 | - | |
| The College Life/ | 2018-12-30 20:07 | - | |
| The Cranberries/ | 2018-12-30 20:07 | - | |
| The Cure/ | 2018-12-30 20:07 | - | |
| The Dead Weather - Horehound 320Kbps [Cov+CD] [Bubanee]/ | 2018-12-30 20:08 | - | |
| The Dear & Departed - Something Quite Peculiar [2007] [Rock] [www.file24ever.com]/ | 2018-12-30 20:08 | - | |
| The Decemberists/ | 2018-12-30 20:08 | - | |
| The Dodos/ | 2018-12-30 20:08 | - | |
| The Doors/ | 2018-12-30 20:08 | - | |
| The Eagles/ | 2018-12-30 20:09 | - | |
| The Early November/ | 2018-12-30 20:09 | - | |
| The Fall Of Troy/ | 2018-12-30 20:09 | - | |
| The Fast And The Furious - Tokyo Drift/ | 2018-12-30 20:09 | - | |
| The Fray/ | 2018-12-30 20:09 | - | |
| The Helio Sequence/ | 2018-12-30 20:10 | - | |
| The Hush Sound/ | 2018-12-30 20:10 | - | |
| The Killers/ | 2018-12-30 20:10 | - | |
| The Lonely Island/ | 2018-12-30 20:10 | - | |
| The Misfits/ | 2018-12-30 20:10 | - | |
| The Naked and Famous/ | 2018-12-30 20:10 | - | |
| The Offspring - Americana/ | 2018-12-30 20:10 | - | |
| The Pixies - Where Is My Mind.mp3 | 2006-05-29 00:05 | 3.5M | |
| The Pixies/ | 2018-12-30 20:10 | - | |
| The Police/ | 2018-12-30 20:10 | - | |
| The Raconteurs - Broken Boy Soldiers/ | 2018-12-30 20:11 | - | |
| The Ramones/ | 2018-12-30 20:11 | - | |
| The Rifles/ | 2018-12-30 20:11 | - | |
| The Rolling Stones/ | 2018-12-30 20:11 | - | |
| The Shins/ | 2018-12-30 20:11 | - | |
| The Smashing Pumpkins/ | 2018-12-30 20:11 | - | |
| The Strokes/ | 2018-12-30 20:11 | - | |
| The Velvet Underground/ | 2018-12-30 20:11 | - | |
| The Von Bondies/ | 2018-12-30 20:12 | - | |
| The White Stripes/ | 2018-12-30 20:12 | - | |
| The Who/ | 2018-12-30 20:12 | - | |
| The_Summer_Obsession-This_Is_Where_You_Belong-(Retail)-2006-RTB/ | 2018-12-30 20:12 | - | |
| Third Eye Blind/ | 2018-12-30 20:12 | - | |
| Three Days Grace/ | 2018-12-30 20:12 | - | |
| Thrice/ | 2018-12-30 20:12 | - | |
| Thursday/ | 2018-12-30 20:12 | - | |
| Tiesto/ | 2018-12-30 20:13 | - | |
| Tom Petty & The Heartbreakers/ | 2018-12-30 20:13 | - | |
| Tom Tom Club/ | 2018-12-30 20:13 | - | |
| Tool/ | 2018-12-30 20:13 | - | |
| Train/ | 2018-12-30 20:14 | - | |
| Trapt/ | 2018-12-30 20:14 | - | |
| Trivium/ | 2018-12-30 20:14 | - | |
| Tyga/ | 2018-12-30 20:14 | - | |
| Tyler The Creator/ | 2018-12-30 20:14 | - | |
| U2/ | 2018-12-30 20:14 | - | |
| UKF/ | 2018-12-30 20:14 | - | |
| Underoath/ | 2018-12-30 20:15 | - | |
| Used/ | 2018-12-30 20:15 | - | |
| Vampire Weekend/ | 2018-12-30 20:15 | - | |
| Warrant/ | 2018-12-30 20:15 | - | |
| Warren G/ | 2018-12-30 20:15 | - | |
| Weezer/ | 2018-12-30 20:15 | - | |
| White Town/ | 2018-12-30 20:15 | - | |
| Wilco/ | 2018-12-30 20:16 | - | |
| Winds Of Plague - a cold day in hell/ | 2018-12-30 20:16 | - | |
| Wiz Khalifa/ | 2018-12-30 20:16 | - | |
| Wu-Tang Clan/ | 2018-12-30 20:16 | - | |
| X-Raided/ | 2018-12-30 20:16 | - | |
| Yellowcard/ | 2018-12-30 20:16 | - | |
| Yolanda Be Cool & DCUP - We No Speak Americano (Original mix).mp3 | 2010-10-20 09:40 | 10M | |
| Young_Love-Too_Young_to_Fight_It-(Proper)-2007-EON/ | 2018-12-30 20:16 | - | |
| ZZ Top/ | 2018-12-30 20:17 | - | |
| Zedd/ | 2018-12-30 20:17 | - | |
| Zeds Dead/ | 2018-12-30 20:17 | - | |
| botch - rock lobster.mp3 | 2007-06-22 06:56 | 2.9M | |
| dead to fall/ | 2018-12-30 19:14 | - | |
| desktop.ini | 2018-12-30 19:08 | 59 | |
| drop dead, gorgeous/ | 2018-12-30 19:19 | - | |
| evergreen terrace/ | 2018-12-30 19:21 | - | |
| haste the day/ | 2018-12-30 19:28 | - | |
| hawthorne heights/ | 2018-12-30 19:28 | - | |
| iTunes/ | 2018-12-30 19:36 | - | |
| it dies today/ | 2018-12-30 19:31 | - | |
| johnny cash- hurt.mp3 | 2007-06-22 06:56 | 5.0M | |
| self against city/ | 2018-12-30 20:00 | - | |
| still remains/ | 2018-12-30 20:03 | - | |
| the starting line-the best of me.mp3 | 2007-06-22 06:56 | 6.0M | |